C18H16N6O2 — CID 18101762
5-nitro-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]benzonitrile (PubChem CID 18101762) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-nitro-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]benzonitrile.
| Compound Name | 5-nitro-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 18101762 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-nitro-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCCC(c2nnc3ccccn23)C1 |
| InChI | InChI=1S/C18H16N6O2/c19-11-14-10-15(24(25)26)6-7-16(14)22-8-3-4-13(12-22)18-21-20-17-5-1-2-9-23(17)18/h1-2,5-7,9-10,13H,3-4,8,12H2 |
| InChIKey | TUBWCJWDQGBICI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|