C20H19F3N6O3 — CID 133345653
N-methyl-5-nitro-2-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]benzamide (PubChem CID 133345653) has the molecular formula C20H19F3N6O3 and a molecular weight of 448.41 g/mol. Its IUPAC name is N-methyl-5-nitro-2-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]benzamide.
| Compound Name | N-methyl-5-nitro-2-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 133345653 |
| Molecular Formula | C20H19F3N6O3 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-methyl-5-nitro-2-[3-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidin-1-yl]benzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC(c2nnc3ccc(C(F)(F)F)cn23)C1 |
| InChI | InChI=1S/C20H19F3N6O3/c1-24-19(30)15-9-14(29(31)32)5-6-16(15)27-8-2-3-12(10-27)18-26-25-17-7-4-13(11-28(17)18)20(21,22)23/h4-7,9,11-12H,2-3,8,10H2,1H3,(H,24,30) |
| InChIKey | WZCUVPQIQNGICN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|