C21H20FN5O4 — CID 86934501
2-[3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-N-methyl-5-nitrobenzamide (PubChem CID 86934501) has the molecular formula C21H20FN5O4 and a molecular weight of 425.42 g/mol. Its IUPAC name is 2-[3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-N-methyl-5-nitrobenzamide.
| Compound Name | 2-[3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 86934501 |
| Molecular Formula | C21H20FN5O4 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-N-methyl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC(c2nc(-c3cccc(F)c3)no2)C1 |
| InChI | InChI=1S/C21H20FN5O4/c1-23-20(28)17-11-16(27(29)30)7-8-18(17)26-9-3-5-14(12-26)21-24-19(25-31-21)13-4-2-6-15(22)10-13/h2,4,6-8,10-11,14H,3,5,9,12H2,1H3,(H,23,28) |
| InChIKey | KUHYGYXDXMCKKK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|