C23H21FN4O5 — CID 52501996
methyl (E)-3-[4-[(3S)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-nitrophenyl]prop-2-enoate (PubChem CID 52501996) has the molecular formula C23H21FN4O5 and a molecular weight of 452.44 g/mol. Its IUPAC name is methyl (E)-3-[4-[(3S)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-nitrophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(3S)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 52501996 |
| Molecular Formula | C23H21FN4O5 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | methyl (E)-3-[4-[(3S)-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-nitrophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N2CCC[C@H](c3nc(-c4ccc(F)cc4)no3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21FN4O5/c1-32-21(29)11-5-15-4-10-19(20(13-15)28(30)31)27-12-2-3-17(14-27)23-25-22(26-33-23)16-6-8-18(24)9-7-16/h4-11,13,17H,2-3,12,14H2,1H3/b11-5+/t17-/m0/s1 |
| InChIKey | QJXZUEMKORVLHN-RIWGIVCCSA-N |
| XLogP | 4.35 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|