C18H20N4O4 — CID 133279836
methyl (E)-3-[4-(4-imidazol-1-ylpiperidin-1-yl)-3-nitrophenyl]prop-2-enoate (PubChem CID 133279836) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl (E)-3-[4-(4-imidazol-1-ylpiperidin-1-yl)-3-nitrophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(4-imidazol-1-ylpiperidin-1-yl)-3-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 133279836 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl (E)-3-[4-(4-imidazol-1-ylpiperidin-1-yl)-3-nitrophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N2CCC(n3ccnc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O4/c1-26-18(23)5-3-14-2-4-16(17(12-14)22(24)25)20-9-6-15(7-10-20)21-11-8-19-13-21/h2-5,8,11-13,15H,6-7,9-10H2,1H3/b5-3+ |
| InChIKey | AMLKSWJIVMWSEX-HWKANZROSA-N |
| XLogP | 2.82 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|