C21H21N5O4S — CID 133487188
methyl (E)-3-[4-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-nitrophenyl]prop-2-enoate (PubChem CID 133487188) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is methyl (E)-3-[4-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-nitrophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 133487188 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | methyl (E)-3-[4-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-nitrophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N2CCN(c3ncnc4sc(C)cc34)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N5O4S/c1-14-11-16-20(22-13-23-21(16)31-14)25-9-7-24(8-10-25)17-5-3-15(4-6-19(27)30-2)12-18(17)26(28)29/h3-6,11-13H,7-10H2,1-2H3/b6-4+ |
| InChIKey | OHJASHTZODPJAF-GQCTYLIASA-N |
| XLogP | 3.42 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|