C18H17N5O3S — CID 39073037
[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 39073037) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is [4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 39073037 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | Cc1cc2c(N3CCN(C(=O)c4cccc([N+](=O)[O-])c4)CC3)ncnc2s1 |
| InChI | InChI=1S/C18H17N5O3S/c1-12-9-15-16(19-11-20-17(15)27-12)21-5-7-22(8-6-21)18(24)13-3-2-4-14(10-13)23(25)26/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | UNYZPVMKJTXICK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|