C22H17ClN6O3S — CID 1462180
[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 1462180) has the molecular formula C22H17ClN6O3S and a molecular weight of 480.94 g/mol. Its IUPAC name is [4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 1462180 |
| Molecular Formula | C22H17ClN6O3S |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(c2ncnc3c(-c4ccc(Cl)cc4)nsc23)CC1 |
| InChI | InChI=1S/C22H17ClN6O3S/c23-16-6-4-14(5-7-16)18-19-20(33-26-18)21(25-13-24-19)27-8-10-28(11-9-27)22(30)15-2-1-3-17(12-15)29(31)32/h1-7,12-13H,8-11H2 |
| InChIKey | KDHXXHSVIWNJAD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 105.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|