C17H17ClN6S2 — CID 1462148
4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-methylpiperazine-1-carbothioamide (PubChem CID 1462148) has the molecular formula C17H17ClN6S2 and a molecular weight of 404.95 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-methylpiperazine-1-carbothioamide.
| Compound Name | 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1462148 |
| Molecular Formula | C17H17ClN6S2 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]-N-methylpiperazine-1-carbothioamide |
| SMILES | CNC(=S)N1CCN(c2ncnc3c(-c4ccc(Cl)cc4)nsc23)CC1 |
| InChI | InChI=1S/C17H17ClN6S2/c1-19-17(25)24-8-6-23(7-9-24)16-15-14(20-10-21-16)13(22-26-15)11-2-4-12(18)5-3-11/h2-5,10H,6-9H2,1H3,(H,19,25) |
| InChIKey | BCTCMOWZFBMMON-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|