C16H16N4OS — CID 1462037
1-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperidin-4-ol (PubChem CID 1462037) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperidin-4-ol.
| Compound Name | 1-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 1462037 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-(3-phenyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)piperidin-4-ol |
| SMILES | OC1CCN(c2ncnc3c(-c4ccccc4)nsc23)CC1 |
| InChI | InChI=1S/C16H16N4OS/c21-12-6-8-20(9-7-12)16-15-14(17-10-18-16)13(19-22-15)11-4-2-1-3-5-11/h1-5,10,12,21H,6-9H2 |
| InChIKey | ZTOJSJUHPLVGEH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |