About 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one
1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one (PubChem CID 1462182) has the molecular formula C18H18ClN5OS
and a molecular weight of 387.90 g/mol. Its IUPAC name is 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one |
| PubChem CID | 1462182 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2ncnc3c(-c4ccc(Cl)cc4)nsc23)CC1 |
| InChI | InChI=1S/C18H18ClN5OS/c1-2-14(25)23-7-9-24(10-8-23)18-17-16(20-11-21-18)15(22-26-17)12-3-5-13(19)6-4-12/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | BQUKWKJLRIXCTE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one?
The IUPAC name of 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one (CID 1462182) is 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one.
What is the SMILES notation for 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one?
The canonical SMILES for 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one is CCC(=O)N1CCN(c2ncnc3c(-c4ccc(Cl)cc4)nsc23)CC1.
What is the InChIKey of 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one?
The InChIKey is BQUKWKJLRIXCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN5OS/c1-2-14(25)23-7-9-24(10-8-23)18-17-16(20-11-21-18)15(22-26-17)12-3-5-13(19)6-4-12/h3-6,11H,2,7-10H2,1H3.
What are the key properties of 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one?
1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one has a molecular weight of 387.90 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3-(4-chlorophenyl)-[1,2]thiazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]propan-1-one is sourced from PubChem (CID 1462182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).