C13H16N4OS — CID 110873227
1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)propan-1-one (PubChem CID 110873227) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110873227 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)propan-1-one |
| SMILES | CCC(=O)N1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-11(18)16-4-6-17(7-5-16)13-12-10(3-8-19-12)14-9-15-13/h3,8-9H,2,4-7H2,1H3 |
| InChIKey | NGZAYGCJDUIAFU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |