C21H26N4OS — CID 51301531
1-adamantyl-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)methanone (PubChem CID 51301531) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-adamantyl-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)methanone.
| Compound Name | 1-adamantyl-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 51301531 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-adamantyl-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
| SMILES | O=C(N1CCN(c2ncnc3ccsc23)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26N4OS/c26-20(21-10-14-7-15(11-21)9-16(8-14)12-21)25-4-2-24(3-5-25)19-18-17(1-6-27-18)22-13-23-19/h1,6,13-16H,2-5,7-12H2 |
| InChIKey | WAIHNIZSNKBRAW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |