C17H27Cl2N5OS — CID 119884627
7-amino-1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)heptan-1-one;dihydrochloride (PubChem CID 119884627) has the molecular formula C17H27Cl2N5OS and a molecular weight of 420.41 g/mol. Its IUPAC name is 7-amino-1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)heptan-1-one;dihydrochloride.
| Compound Name | 7-amino-1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)heptan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119884627 |
| Molecular Formula | C17H27Cl2N5OS |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 7-amino-1-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)heptan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)N1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C17H25N5OS.2ClH/c18-7-4-2-1-3-5-15(23)21-8-10-22(11-9-21)17-16-14(6-12-24-16)19-13-20-17;;/h6,12-13H,1-5,7-11,18H2;2*1H |
| InChIKey | OSZLHKKCINQPRW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|