C21H20ClN5O3 — CID 42809335
[4-(7-chloro-2-ethylquinazolin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 42809335) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is [4-(7-chloro-2-ethylquinazolin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(7-chloro-2-ethylquinazolin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42809335 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [4-(7-chloro-2-ethylquinazolin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | CCc1nc(N2CCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C21H20ClN5O3/c1-2-19-23-18-13-15(22)6-7-17(18)20(24-19)25-8-10-26(11-9-25)21(28)14-4-3-5-16(12-14)27(29)30/h3-7,12-13H,2,8-11H2,1H3 |
| InChIKey | NWDQNGJKOIWZFU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|