C28H27N5O3S — CID 42799596
[4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 42799596) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is [4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42799596 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(c2nc(Cc3ccccc3)nc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C28H27N5O3S/c34-28(20-9-6-10-21(18-20)33(35)36)32-15-13-31(14-16-32)26-25-22-11-4-5-12-23(22)37-27(25)30-24(29-26)17-19-7-2-1-3-8-19/h1-3,6-10,18H,4-5,11-17H2 |
| InChIKey | PIZIRTANZKNPDN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|