C25H29N5O3S — CID 42803068
(4-nitrophenyl)-[4-(5-propan-2-yl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone (PubChem CID 42803068) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-(5-propan-2-yl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-nitrophenyl)-[4-(5-propan-2-yl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42803068 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (4-nitrophenyl)-[4-(5-propan-2-yl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone |
| SMILES | CC(C)c1nc(N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C25H29N5O3S/c1-16(2)22-26-23(21-19-6-4-3-5-7-20(19)34-24(21)27-22)28-12-14-29(15-13-28)25(31)17-8-10-18(11-9-17)30(32)33/h8-11,16H,3-7,12-15H2,1-2H3 |
| InChIKey | FKAIBERCEIUDHN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|