C20H23N5O3 — CID 133461092
[4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 133461092) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is [4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 133461092 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [4-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1nc2c(c(N3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)n1)CCCC2 |
| InChI | InChI=1S/C20H23N5O3/c1-14-21-18-5-3-2-4-17(18)19(22-14)23-10-12-24(13-11-23)20(26)15-6-8-16(9-7-15)25(27)28/h6-9H,2-5,10-13H2,1H3 |
| InChIKey | HABRIDKSDNFPIV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|