C22H22N4O3 — CID 108754718
[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 108754718) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108754718 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C22H22N4O3/c1-15-4-3-5-19-16(2)14-20(23-21(15)19)24-10-12-25(13-11-24)22(27)17-6-8-18(9-7-17)26(28)29/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | MJIBDYUDAWUFOM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|