C23H23N5O5 — CID 108731197
[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone (PubChem CID 108731197) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone.
| Compound Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 108731197 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)N2CCN(c3cc(C)c4cccc(C)c4n3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N5O5/c1-14-5-4-6-18-15(2)11-21(24-22(14)18)25-7-9-26(10-8-25)23(29)17-12-19(27(30)31)16(3)20(13-17)28(32)33/h4-6,11-13H,7-10H2,1-3H3 |
| InChIKey | YZSSVUBECCJJKK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|