C28H27N3O2 — CID 108731152
[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(3-phenoxyphenyl)methanone (PubChem CID 108731152) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(3-phenoxyphenyl)methanone.
| Compound Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(3-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 108731152 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | [4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-(3-phenoxyphenyl)methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3cccc(Oc4ccccc4)c3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C28H27N3O2/c1-20-8-6-13-25-21(2)18-26(29-27(20)25)30-14-16-31(17-15-30)28(32)22-9-7-12-24(19-22)33-23-10-4-3-5-11-23/h3-13,18-19H,14-17H2,1-2H3 |
| InChIKey | SUPDDXUKPJZNEL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |