C28H30N4O3 — CID 108754755
2-butan-2-yl-5-[4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 108754755) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-butan-2-yl-5-[4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butan-2-yl-5-[4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108754755 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-butan-2-yl-5-[4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCC(C)N1C(=O)c2ccc(C(=O)N3CCN(c4cc(C)c5cccc(C)c5n4)CC3)cc2C1=O |
| InChI | InChI=1S/C28H30N4O3/c1-5-19(4)32-27(34)22-10-9-20(16-23(22)28(32)35)26(33)31-13-11-30(12-14-31)24-15-18(3)21-8-6-7-17(2)25(21)29-24/h6-10,15-16,19H,5,11-14H2,1-4H3 |
| InChIKey | PRDCHICLIXVVDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|