2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid

C17H21N3O2 — CID 82166224

IUPAC2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid
SMILESCc1cc(N2CCN(CC(=O)O)CC2)nc2c(C)cccc12
InChIInChI=1S/C17H21N3O2/c1-12-4-3-5-14-13(2)10-15(18-17(12)14)20-8-6-19(7-9-20)11-16(21)22/h3-5,10H,6-9,11H2,1-2H3,(H,21,22)
InChIKeyZCZNLJTUGGHWIV-UHFFFAOYSA-N
MW299.37 g/mol
LogP2.06
Rot. Bonds3

About 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid

2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid (PubChem CID 82166224) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid
PubChem CID82166224
Molecular FormulaC17H21N3O2
Molecular Weight299.37 g/mol
Exact Mass299.16
IUPAC Name2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid
SMILESCc1cc(N2CCN(CC(=O)O)CC2)nc2c(C)cccc12
InChIInChI=1S/C17H21N3O2/c1-12-4-3-5-14-13(2)10-15(18-17(12)14)20-8-6-19(7-9-20)11-16(21)22/h3-5,10H,6-9,11H2,1-2H3,(H,21,22)
InChIKeyZCZNLJTUGGHWIV-UHFFFAOYSA-N
XLogP2.06
TPSA56.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.37
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid (CID 82166224) is 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid is Cc1cc(N2CCN(CC(=O)O)CC2)nc2c(C)cccc12.
What is the InChIKey of 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid?
The InChIKey is ZCZNLJTUGGHWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-12-4-3-5-14-13(2)10-15(18-17(12)14)20-8-6-19(7-9-20)11-16(21)22/h3-5,10H,6-9,11H2,1-2H3,(H,21,22).
What are the key properties of 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid?
2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid has a molecular weight of 299.37 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid is sourced from PubChem (CID 82166224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).