C17H21N3O2 — CID 82166224
2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid (PubChem CID 82166224) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 82166224 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]acetic acid |
| SMILES | Cc1cc(N2CCN(CC(=O)O)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C17H21N3O2/c1-12-4-3-5-14-13(2)10-15(18-17(12)14)20-8-6-19(7-9-20)11-16(21)22/h3-5,10H,6-9,11H2,1-2H3,(H,21,22) |
| InChIKey | ZCZNLJTUGGHWIV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |