C18H21F3N2O2 — CID 46891914
4,8-dimethyl-2-piperidin-1-ylquinoline;2,2,2-trifluoroacetic acid (PubChem CID 46891914) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4,8-dimethyl-2-piperidin-1-ylquinoline;2,2,2-trifluoroacetic acid.
| Compound Name | 4,8-dimethyl-2-piperidin-1-ylquinoline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46891914 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4,8-dimethyl-2-piperidin-1-ylquinoline;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N2CCCCC2)nc2c(C)cccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N2.C2HF3O2/c1-12-7-6-8-14-13(2)11-15(17-16(12)14)18-9-4-3-5-10-18;3-2(4,5)1(6)7/h6-8,11H,3-5,9-10H2,1-2H3;(H,6,7) |
| InChIKey | HETKAJIQWFJGAM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |