C22H30N4S — CID 108781210
N-cyclohexyl-4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbothioamide (PubChem CID 108781210) has the molecular formula C22H30N4S and a molecular weight of 382.58 g/mol. Its IUPAC name is N-cyclohexyl-4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 108781210 |
| Molecular Formula | C22H30N4S |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-cyclohexyl-4-(4,8-dimethylquinolin-2-yl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(N2CCN(C(=S)NC3CCCCC3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C22H30N4S/c1-16-7-6-10-19-17(2)15-20(24-21(16)19)25-11-13-26(14-12-25)22(27)23-18-8-4-3-5-9-18/h6-7,10,15,18H,3-5,8-9,11-14H2,1-2H3,(H,23,27) |
| InChIKey | FKEQIWLOZCUWMY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|