C18H27N3S — CID 17371349
N-cyclopentyl-4-(2,3-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 17371349) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,3-dimethylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-cyclopentyl-4-(2,3-dimethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17371349 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-cyclopentyl-4-(2,3-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc(N2CCN(C(=S)NC3CCCC3)CC2)c1C |
| InChI | InChI=1S/C18H27N3S/c1-14-6-5-9-17(15(14)2)20-10-12-21(13-11-20)18(22)19-16-7-3-4-8-16/h5-6,9,16H,3-4,7-8,10-13H2,1-2H3,(H,19,22) |
| InChIKey | YSECIMMIIFFDCM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|