C26H33N3O — CID 108731208
1-adamantyl-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone (PubChem CID 108731208) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-adamantyl-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone.
| Compound Name | 1-adamantyl-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108731208 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-adamantyl-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(N2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C26H33N3O/c1-17-4-3-5-22-18(2)10-23(27-24(17)22)28-6-8-29(9-7-28)25(30)26-14-19-11-20(15-26)13-21(12-19)16-26/h3-5,10,19-21H,6-9,11-16H2,1-2H3 |
| InChIKey | KFHKJJIKOPOIMU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |