C23H32N2O — CID 2941646
1-adamantyl-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 2941646) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-adamantyl-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | 1-adamantyl-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2941646 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-adamantyl-[4-(3,4-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1C |
| InChI | InChI=1S/C23H32N2O/c1-16-3-4-21(9-17(16)2)24-5-7-25(8-6-24)22(26)23-13-18-10-19(14-23)12-20(11-18)15-23/h3-4,9,18-20H,5-8,10-15H2,1-2H3 |
| InChIKey | OFFQYGSGJUJTNN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|