C19H24N2OS — CID 7743628
(2R)-N-cyclopentyl-2-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide (PubChem CID 7743628) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-cyclopentyl-2-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7743628 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-N-cyclopentyl-2-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide |
| SMILES | Cc1cc(S[C@H](C)C(=O)NC2CCCC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C19H24N2OS/c1-12-7-6-10-16-13(2)11-17(21-18(12)16)23-14(3)19(22)20-15-8-4-5-9-15/h6-7,10-11,14-15H,4-5,8-9H2,1-3H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | LTAHODDIQYPFPH-CQSZACIVSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |