C24H26N4O5 — CID 108731183
(4,5-dimethoxy-2-nitrophenyl)-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone (PubChem CID 108731183) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108731183 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(c3cc(C)c4cccc(C)c4n3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H26N4O5/c1-15-6-5-7-17-16(2)12-22(25-23(15)17)26-8-10-27(11-9-26)24(29)18-13-20(32-3)21(33-4)14-19(18)28(30)31/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | PKZZQUWYMLGDOQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|