C18H21N5O5 — CID 121060494
(4,5-dimethoxy-2-nitrophenyl)-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 121060494) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121060494 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(c3ccc(C)nn3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H21N5O5/c1-12-4-5-17(20-19-12)21-6-8-22(9-7-21)18(24)13-10-15(27-2)16(28-3)11-14(13)23(25)26/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | KIOUEIJIAUFVDQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|