C21H23N5O5 — CID 51132499
[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(4,5-dimethoxy-2-nitrophenyl)methanone (PubChem CID 51132499) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(4,5-dimethoxy-2-nitrophenyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(4,5-dimethoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 51132499 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(4,5-dimethoxy-2-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCCN(c3nc4ccccc4[nH]3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H23N5O5/c1-30-18-12-14(17(26(28)29)13-19(18)31-2)20(27)24-8-5-9-25(11-10-24)21-22-15-6-3-4-7-16(15)23-21/h3-4,6-7,12-13H,5,8-11H2,1-2H3,(H,22,23) |
| InChIKey | JHMDZACZNUAKCS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|