C20H20N6O5 — CID 75456718
(2-methyl-5-nitrophenyl)-[4-(6-nitro-1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 75456718) has the molecular formula C20H20N6O5 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2-methyl-5-nitrophenyl)-[4-(6-nitro-1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-methyl-5-nitrophenyl)-[4-(6-nitro-1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 75456718 |
| Molecular Formula | C20H20N6O5 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (2-methyl-5-nitrophenyl)-[4-(6-nitro-1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)N1CCCN(c2nc3ccc([N+](=O)[O-])cc3[nH]2)CC1 |
| InChI | InChI=1S/C20H20N6O5/c1-13-3-4-14(25(28)29)11-16(13)19(27)23-7-2-8-24(10-9-23)20-21-17-6-5-15(26(30)31)12-18(17)22-20/h3-6,11-12H,2,7-10H2,1H3,(H,21,22) |
| InChIKey | RCYWTGVAIBFOCJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|