C16H24N6O4S — CID 75524530
N-methyl-4-(6-nitro-1H-benzimidazol-2-yl)-N-propyl-1,4-diazepane-1-sulfonamide (PubChem CID 75524530) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-methyl-4-(6-nitro-1H-benzimidazol-2-yl)-N-propyl-1,4-diazepane-1-sulfonamide.
| Compound Name | N-methyl-4-(6-nitro-1H-benzimidazol-2-yl)-N-propyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 75524530 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-methyl-4-(6-nitro-1H-benzimidazol-2-yl)-N-propyl-1,4-diazepane-1-sulfonamide |
| SMILES | CCCN(C)S(=O)(=O)N1CCCN(c2nc3ccc([N+](=O)[O-])cc3[nH]2)CC1 |
| InChI | InChI=1S/C16H24N6O4S/c1-3-7-19(2)27(25,26)21-9-4-8-20(10-11-21)16-17-14-6-5-13(22(23)24)12-15(14)18-16/h5-6,12H,3-4,7-11H2,1-2H3,(H,17,18) |
| InChIKey | ZYXMSENNVPUCPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|