C22H25ClN6O — CID 86942580
[4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(2-chloro-6-pyrrolidin-1-yl-4-pyridinyl)methanone (PubChem CID 86942580) has the molecular formula C22H25ClN6O and a molecular weight of 424.94 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(2-chloro-6-pyrrolidin-1-yl-4-pyridinyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(2-chloro-6-pyrrolidin-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 86942580 |
| Molecular Formula | C22H25ClN6O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)-1,4-diazepan-1-yl]-(2-chloro-6-pyrrolidin-1-yl-4-pyridinyl)methanone |
| SMILES | O=C(c1cc(Cl)nc(N2CCCC2)c1)N1CCCN(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H25ClN6O/c23-19-14-16(15-20(26-19)27-8-3-4-9-27)21(30)28-10-5-11-29(13-12-28)22-24-17-6-1-2-7-18(17)25-22/h1-2,6-7,14-15H,3-5,8-13H2,(H,24,25) |
| InChIKey | DNTSJEPZHCDKAI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|