C24H22N4O — CID 44565640
[4-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 44565640) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 44565640 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCN(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H22N4O/c29-23(20-12-10-19(11-13-20)18-6-2-1-3-7-18)27-14-16-28(17-15-27)24-25-21-8-4-5-9-22(21)26-24/h1-13H,14-17H2,(H,25,26) |
| InChIKey | OAJQDPZNYNKFBE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |