C26H29N5O5 — CID 108741833
[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 108741833) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is [4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108741833 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | COc1cccc2c(C)cc(N3CCN(C(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)CC3)nc12 |
| InChI | InChI=1S/C26H29N5O5/c1-18-16-24(27-25-20(18)4-3-5-23(25)35-2)29-8-10-30(11-9-29)26(32)19-6-7-21(22(17-19)31(33)34)28-12-14-36-15-13-28/h3-7,16-17H,8-15H2,1-2H3 |
| InChIKey | XCBBMLWMCODNNY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 101.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|