C26H28N6O4 — CID 108736884
[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 108736884) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is [4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108736884 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | Cc1nc(-c2ccccc2)cc(N2CCN(C(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C26H28N6O4/c1-19-27-22(20-5-3-2-4-6-20)18-25(28-19)30-9-11-31(12-10-30)26(33)21-7-8-23(24(17-21)32(34)35)29-13-15-36-16-14-29/h2-8,17-18H,9-16H2,1H3 |
| InChIKey | OQKDJBYCAPHXAM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|