C30H31N5O7 — CID 17091853
methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]benzoate (PubChem CID 17091853) has the molecular formula C30H31N5O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 17091853 |
| Molecular Formula | C30H31N5O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C30H31N5O7/c1-41-30(38)23-8-9-25(32-11-13-34(14-12-32)29(37)21-5-3-2-4-6-21)24(19-23)31-28(36)22-7-10-26(27(20-22)35(39)40)33-15-17-42-18-16-33/h2-10,19-20H,11-18H2,1H3,(H,31,36) |
| InChIKey | QLNJTFWOWFRENG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|