C33H37N5O6 — CID 43914684
ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]amino]benzoate (PubChem CID 43914684) has the molecular formula C33H37N5O6 and a molecular weight of 599.69 g/mol. Its IUPAC name is ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]amino]benzoate.
| Compound Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 43914684 |
| Molecular Formula | C33H37N5O6 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)c2ccc(N3CCC(C)CC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C33H37N5O6/c1-3-44-33(41)26-10-11-28(36-17-19-37(20-18-36)32(40)24-7-5-4-6-8-24)27(21-26)34-31(39)25-9-12-29(30(22-25)38(42)43)35-15-13-23(2)14-16-35/h4-12,21-23H,3,13-20H2,1-2H3,(H,34,39) |
| InChIKey | ARKYKXZHNCSUFB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|