C28H29N3O4 — CID 17091506
methyl 4-(4-benzoylpiperazin-1-yl)-3-[(3,5-dimethylbenzoyl)amino]benzoate (PubChem CID 17091506) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[(3,5-dimethylbenzoyl)amino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(3,5-dimethylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 17091506 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(3,5-dimethylbenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C28H29N3O4/c1-19-15-20(2)17-23(16-19)26(32)29-24-18-22(28(34)35-3)9-10-25(24)30-11-13-31(14-12-30)27(33)21-7-5-4-6-8-21/h4-10,15-18H,11-14H2,1-3H3,(H,29,32) |
| InChIKey | YGDPXMJXWVVSRD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |