C28H29N3O6 — CID 17334081
methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2,6-dimethoxybenzoyl)amino]benzoate (PubChem CID 17334081) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2,6-dimethoxybenzoyl)amino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2,6-dimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 17334081 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2,6-dimethoxybenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C28H29N3O6/c1-35-23-10-7-11-24(36-2)25(23)26(32)29-21-18-20(28(34)37-3)12-13-22(21)30-14-16-31(17-15-30)27(33)19-8-5-4-6-9-19/h4-13,18H,14-17H2,1-3H3,(H,29,32) |
| InChIKey | GXCZTYMEHWBTDD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |