C30H26BrN3O5 — CID 17092159
methyl 4-(4-benzoylpiperazin-1-yl)-3-[[5-(4-bromophenyl)furan-2-carbonyl]amino]benzoate (PubChem CID 17092159) has the molecular formula C30H26BrN3O5 and a molecular weight of 588.46 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[[5-(4-bromophenyl)furan-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[[5-(4-bromophenyl)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 17092159 |
| Molecular Formula | C30H26BrN3O5 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[[5-(4-bromophenyl)furan-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)c2ccc(-c3ccc(Br)cc3)o2)c1 |
| InChI | InChI=1S/C30H26BrN3O5/c1-38-30(37)22-9-12-25(33-15-17-34(18-16-33)29(36)21-5-3-2-4-6-21)24(19-22)32-28(35)27-14-13-26(39-27)20-7-10-23(31)11-8-20/h2-14,19H,15-18H2,1H3,(H,32,35) |
| InChIKey | MNWNQYCIKJLMJX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |