C30H28BrN3O3 — CID 17050290
5-(4-bromophenyl)-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17050290) has the molecular formula C30H28BrN3O3 and a molecular weight of 558.48 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17050290 |
| Molecular Formula | C30H28BrN3O3 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 5-(4-bromophenyl)-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(-c5ccc(Br)cc5)o4)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H28BrN3O3/c1-2-21-3-5-23(6-4-21)30(36)34-19-17-33(18-20-34)26-13-11-25(12-14-26)32-29(35)28-16-15-27(37-28)22-7-9-24(31)10-8-22/h3-16H,2,17-20H2,1H3,(H,32,35) |
| InChIKey | LUOCZQYKPMVPQF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|