C28H31N3O4 — CID 17358556
N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 17358556) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17358556 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(OC)c(OC)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-4-20-5-7-21(8-6-20)28(33)31-17-15-30(16-18-31)24-12-10-23(11-13-24)29-27(32)22-9-14-25(34-2)26(19-22)35-3/h5-14,19H,4,15-18H2,1-3H3,(H,29,32) |
| InChIKey | AXNJCCPDOYUANH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|