C32H39N3O5 — CID 17358334
3,4,5-triethoxy-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17358334) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17358334 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(N3CCN(C(=O)c4ccc(CC)cc4)CC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C32H39N3O5/c1-5-23-9-11-24(12-10-23)32(37)35-19-17-34(18-20-35)27-15-13-26(14-16-27)33-31(36)25-21-28(38-6-2)30(40-8-4)29(22-25)39-7-3/h9-16,21-22H,5-8,17-20H2,1-4H3,(H,33,36) |
| InChIKey | DLFXDZYXBYVRBZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|