C25H29N3O5 — CID 168569737
dimethyl (E)-2-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]anilino]but-2-enedioate (PubChem CID 168569737) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569737 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | dimethyl (E)-2-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]anilino]but-2-enedioate |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(N/C(=C/C(=O)OC)C(=O)OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-4-18-5-7-19(8-6-18)24(30)28-15-13-27(14-16-28)21-11-9-20(10-12-21)26-22(25(31)33-3)17-23(29)32-2/h5-12,17,26H,4,13-16H2,1-3H3/b22-17+ |
| InChIKey | XROORJWMNHWTRY-OQKWZONESA-N |
| XLogP | 2.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|