C26H26IN3O2 — CID 17358702
N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-2-iodobenzamide (PubChem CID 17358702) has the molecular formula C26H26IN3O2 and a molecular weight of 539.42 g/mol. Its IUPAC name is N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-2-iodobenzamide.
| Compound Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 17358702 |
| Molecular Formula | C26H26IN3O2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-2-iodobenzamide |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4ccccc4I)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H26IN3O2/c1-2-19-7-9-20(10-8-19)26(32)30-17-15-29(16-18-30)22-13-11-21(12-14-22)28-25(31)23-5-3-4-6-24(23)27/h3-14H,2,15-18H2,1H3,(H,28,31) |
| InChIKey | YSHLOYKRSAXLTE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|