C22H27N3O5 — CID 168595587
methyl 4-(4-benzoylpiperazin-1-yl)-3-(2,3-dihydroxypropylamino)benzoate (PubChem CID 168595587) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-(2,3-dihydroxypropylamino)benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-(2,3-dihydroxypropylamino)benzoate |
|---|---|
| PubChem CID | 168595587 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-(2,3-dihydroxypropylamino)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-30-22(29)17-7-8-20(19(13-17)23-14-18(27)15-26)24-9-11-25(12-10-24)21(28)16-5-3-2-4-6-16/h2-8,13,18,23,26-27H,9-12,14-15H2,1H3 |
| InChIKey | NNDIEBXACUPSAC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |