C21H24N2O3 — CID 132548762
methyl 3-(4-benzoylpiperazin-1-yl)-4,5-dimethylbenzoate (PubChem CID 132548762) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl 3-(4-benzoylpiperazin-1-yl)-4,5-dimethylbenzoate.
| Compound Name | methyl 3-(4-benzoylpiperazin-1-yl)-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 132548762 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | methyl 3-(4-benzoylpiperazin-1-yl)-4,5-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C)c(C)c(N2CCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-13-18(21(25)26-3)14-19(16(15)2)22-9-11-23(12-10-22)20(24)17-7-5-4-6-8-17/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | HBAXUFLZFGYPIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |